About 2,2-diethyl-1-hydroxy-6,6-dimethylpiperidin-4-ol
2,2-diethyl-1-hydroxy-6,6-dimethylpiperidin-4-ol (PubChem CID 22341845) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is 2,2-diethyl-1-hydroxy-6,6-dimethylpiperidin-4-ol.
Molecular Properties
| Compound Name | 2,2-diethyl-1-hydroxy-6,6-dimethylpiperidin-4-ol |
| PubChem CID | 22341845 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 2,2-diethyl-1-hydroxy-6,6-dimethylpiperidin-4-ol |
| SMILES | CCC1(CC)CC(O)CC(C)(C)N1O |
| InChI | InChI=1S/C11H23NO2/c1-5-11(6-2)8-9(13)7-10(3,4)12(11)14/h9,13-14H,5-8H2,1-4H3 |
| InChIKey | GLFNYQLGZDSEFR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-diethyl-1-hydroxy-6,6-dimethylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethyl-1-hydroxy-6,6-dimethylpiperidin-4-ol?
The IUPAC name of 2,2-diethyl-1-hydroxy-6,6-dimethylpiperidin-4-ol (CID 22341845) is 2,2-diethyl-1-hydroxy-6,6-dimethylpiperidin-4-ol.
What is the SMILES notation for 2,2-diethyl-1-hydroxy-6,6-dimethylpiperidin-4-ol?
The canonical SMILES for 2,2-diethyl-1-hydroxy-6,6-dimethylpiperidin-4-ol is CCC1(CC)CC(O)CC(C)(C)N1O.
What is the InChIKey of 2,2-diethyl-1-hydroxy-6,6-dimethylpiperidin-4-ol?
The InChIKey is GLFNYQLGZDSEFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-5-11(6-2)8-9(13)7-10(3,4)12(11)14/h9,13-14H,5-8H2,1-4H3.
What are the key properties of 2,2-diethyl-1-hydroxy-6,6-dimethylpiperidin-4-ol?
2,2-diethyl-1-hydroxy-6,6-dimethylpiperidin-4-ol has a molecular weight of 201.31 g/mol, XLogP of 2.17, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-1-hydroxy-6,6-dimethylpiperidin-4-ol is sourced from PubChem (CID 22341845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).