C20H33NO2 — CID 22341851
2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-ol (PubChem CID 22341851) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-ol.
| Compound Name | 2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-ol |
|---|---|
| PubChem CID | 22341851 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 2,6-diethyl-2,3,6-trimethyl-1-(1-phenylethoxy)piperidin-4-ol |
| SMILES | CCC1(C)CC(O)C(C)C(C)(CC)N1OC(C)c1ccccc1 |
| InChI | InChI=1S/C20H33NO2/c1-7-19(5)14-18(22)15(3)20(6,8-2)21(19)23-16(4)17-12-10-9-11-13-17/h9-13,15-16,18,22H,7-8,14H2,1-6H3 |
| InChIKey | DGSTWPUWTGYKAY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |