C5H9AuN3S+ — CID 22342380
gold(1+);1,4,5-trimethyl-1,2,4-triazol-4-ium-3-thiolate (PubChem CID 22342380) has the molecular formula C5H9AuN3S+ and a molecular weight of 340.18 g/mol. Its IUPAC name is gold(1+);1,4,5-trimethyl-1,2,4-triazol-4-ium-3-thiolate.
| Compound Name | gold(1+);1,4,5-trimethyl-1,2,4-triazol-4-ium-3-thiolate |
|---|---|
| PubChem CID | 22342380 |
| Molecular Formula | C5H9AuN3S+ |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | gold(1+);1,4,5-trimethyl-1,2,4-triazol-4-ium-3-thiolate |
| SMILES | Cc1n(C)nc([S-])[n+]1C.[Au+] |
| InChI | InChI=1S/C5H9N3S.Au/c1-4-7(2)5(9)6-8(4)3;/h1-3H3;/q;+1 |
| InChIKey | BYOVJKHNCXVEOM-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|