About 1-(Silyloxy)ethan-1-ol
1-(Silyloxy)ethan-1-ol (PubChem CID 22342397) has the molecular formula C2H5O2Si
and a molecular weight of 89.15 g/mol.
Molecular Properties
| Compound Name | 1-(Silyloxy)ethan-1-ol |
| PubChem CID | 22342397 |
| Molecular Formula | C2H5O2Si |
| Molecular Weight | 89.15 g/mol |
| Exact Mass | 89.01 |
| IUPAC Name | — |
| SMILES | CC(O)O[Si] |
| InChI | InChI=1S/C2H5O2Si/c1-2(3)4-5/h2-3H,1H3 |
| InChIKey | GQRGLXWQFGEIJU-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.15 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(Silyloxy)ethan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(Silyloxy)ethan-1-ol?
The IUPAC name of 1-(Silyloxy)ethan-1-ol (CID 22342397) is not available.
What is the SMILES notation for 1-(Silyloxy)ethan-1-ol?
The canonical SMILES for 1-(Silyloxy)ethan-1-ol is CC(O)O[Si].
What is the InChIKey of 1-(Silyloxy)ethan-1-ol?
The InChIKey is GQRGLXWQFGEIJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5O2Si/c1-2(3)4-5/h2-3H,1H3.
What are the key properties of 1-(Silyloxy)ethan-1-ol?
1-(Silyloxy)ethan-1-ol has a molecular weight of 89.15 g/mol, XLogP of -0.58, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(Silyloxy)ethan-1-ol is sourced from PubChem (CID 22342397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).