About N-[3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propyl]propanamide
N-[3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propyl]propanamide (PubChem CID 22343202) has the molecular formula C13H17N5O2
and a molecular weight of 275.31 g/mol. Its IUPAC name is N-[3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propyl]propanamide.
Molecular Properties
| Compound Name | N-[3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propyl]propanamide |
| PubChem CID | 22343202 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-[3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propyl]propanamide |
| SMILES | CCC(=O)NCCCNc1n[nH]c(=O)c2cccnc12 |
| InChI | InChI=1S/C13H17N5O2/c1-2-10(19)14-7-4-8-16-12-11-9(5-3-6-15-11)13(20)18-17-12/h3,5-6H,2,4,7-8H2,1H3,(H,14,19)(H,16,17)(H,18,20) |
| InChIKey | LAGQXSCCMDESCK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propyl]propanamide?
The IUPAC name of N-[3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propyl]propanamide (CID 22343202) is N-[3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propyl]propanamide.
What is the SMILES notation for N-[3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propyl]propanamide?
The canonical SMILES for N-[3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propyl]propanamide is CCC(=O)NCCCNc1n[nH]c(=O)c2cccnc12.
What is the InChIKey of N-[3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propyl]propanamide?
The InChIKey is LAGQXSCCMDESCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5O2/c1-2-10(19)14-7-4-8-16-12-11-9(5-3-6-15-11)13(20)18-17-12/h3,5-6H,2,4,7-8H2,1H3,(H,14,19)(H,16,17)(H,18,20).
What are the key properties of N-[3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propyl]propanamide?
N-[3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propyl]propanamide has a molecular weight of 275.31 g/mol, XLogP of 0.65, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propyl]propanamide is sourced from PubChem (CID 22343202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).