About 3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propanamide
3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propanamide (PubChem CID 22343230) has the molecular formula C10H11N5O2
and a molecular weight of 233.23 g/mol. Its IUPAC name is 3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propanamide.
Molecular Properties
| Compound Name | 3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propanamide |
| PubChem CID | 22343230 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propanamide |
| SMILES | NC(=O)CCNc1n[nH]c(=O)c2cccnc12 |
| InChI | InChI=1S/C10H11N5O2/c11-7(16)3-5-13-9-8-6(2-1-4-12-8)10(17)15-14-9/h1-2,4H,3,5H2,(H2,11,16)(H,13,14)(H,15,17) |
| InChIKey | SLFCBAJZBNINDF-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propanamide?
The IUPAC name of 3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propanamide (CID 22343230) is 3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propanamide.
What is the SMILES notation for 3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propanamide?
The canonical SMILES for 3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propanamide is NC(=O)CCNc1n[nH]c(=O)c2cccnc12.
What is the InChIKey of 3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propanamide?
The InChIKey is SLFCBAJZBNINDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N5O2/c11-7(16)3-5-13-9-8-6(2-1-4-12-8)10(17)15-14-9/h1-2,4H,3,5H2,(H2,11,16)(H,13,14)(H,15,17).
What are the key properties of 3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propanamide?
3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propanamide has a molecular weight of 233.23 g/mol, XLogP of -0.39, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-oxo-6H-pyrido[2,3-d]pyridazin-8-yl)amino]propanamide is sourced from PubChem (CID 22343230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).