About pyrrolidin-1-yl-(2,4,5-trimethoxyphenyl)methanethione
pyrrolidin-1-yl-(2,4,5-trimethoxyphenyl)methanethione (PubChem CID 2234365) has the molecular formula C14H19NO3S
and a molecular weight of 281.38 g/mol. Its IUPAC name is pyrrolidin-1-yl-(2,4,5-trimethoxyphenyl)methanethione.
Molecular Properties
| Compound Name | pyrrolidin-1-yl-(2,4,5-trimethoxyphenyl)methanethione |
| PubChem CID | 2234365 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | pyrrolidin-1-yl-(2,4,5-trimethoxyphenyl)methanethione |
| SMILES | COc1cc(OC)c(C(=S)N2CCCC2)cc1OC |
| InChI | InChI=1S/C14H19NO3S/c1-16-11-9-13(18-3)12(17-2)8-10(11)14(19)15-6-4-5-7-15/h8-9H,4-7H2,1-3H3 |
| InChIKey | VMHZZINIMMPWKK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze pyrrolidin-1-yl-(2,4,5-trimethoxyphenyl)methanethione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-1-yl-(2,4,5-trimethoxyphenyl)methanethione?
The IUPAC name of pyrrolidin-1-yl-(2,4,5-trimethoxyphenyl)methanethione (CID 2234365) is pyrrolidin-1-yl-(2,4,5-trimethoxyphenyl)methanethione.
What is the SMILES notation for pyrrolidin-1-yl-(2,4,5-trimethoxyphenyl)methanethione?
The canonical SMILES for pyrrolidin-1-yl-(2,4,5-trimethoxyphenyl)methanethione is COc1cc(OC)c(C(=S)N2CCCC2)cc1OC.
What is the InChIKey of pyrrolidin-1-yl-(2,4,5-trimethoxyphenyl)methanethione?
The InChIKey is VMHZZINIMMPWKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3S/c1-16-11-9-13(18-3)12(17-2)8-10(11)14(19)15-6-4-5-7-15/h8-9H,4-7H2,1-3H3.
What are the key properties of pyrrolidin-1-yl-(2,4,5-trimethoxyphenyl)methanethione?
pyrrolidin-1-yl-(2,4,5-trimethoxyphenyl)methanethione has a molecular weight of 281.38 g/mol, XLogP of 2.48, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-1-yl-(2,4,5-trimethoxyphenyl)methanethione is sourced from PubChem (CID 2234365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).