C15H7ClF5N3O2S — CID 2234371
4-(4-chlorophenyl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylpyrazol-3-amine (PubChem CID 2234371) has the molecular formula C15H7ClF5N3O2S and a molecular weight of 423.75 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylpyrazol-3-amine.
| Compound Name | 4-(4-chlorophenyl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylpyrazol-3-amine |
|---|---|
| PubChem CID | 2234371 |
| Molecular Formula | C15H7ClF5N3O2S |
| Molecular Weight | 423.75 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | 4-(4-chlorophenyl)-1-(2,3,4,5,6-pentafluorophenyl)sulfonylpyrazol-3-amine |
| SMILES | Nc1nn(S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H7ClF5N3O2S/c16-7-3-1-6(2-4-7)8-5-24(23-15(8)22)27(25,26)14-12(20)10(18)9(17)11(19)13(14)21/h1-5H,(H2,22,23) |
| InChIKey | LRMYKCNRORSKPQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.75 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|