About (7-methoxy-2,2-dimethyl-3H-1-benzofuran-5-yl)methyl-triphenylphosphanium bromide
(7-methoxy-2,2-dimethyl-3H-1-benzofuran-5-yl)methyl-triphenylphosphanium bromide (PubChem CID 22343760) has the molecular formula C30H30BrO2P
and a molecular weight of 533.45 g/mol. Its IUPAC name is (7-methoxy-2,2-dimethyl-3H-1-benzofuran-5-yl)methyl-triphenylphosphanium bromide.
Molecular Properties
| Compound Name | (7-methoxy-2,2-dimethyl-3H-1-benzofuran-5-yl)methyl-triphenylphosphanium bromide |
| PubChem CID | 22343760 |
| Molecular Formula | C30H30BrO2P |
| Molecular Weight | 533.45 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | (7-methoxy-2,2-dimethyl-3H-1-benzofuran-5-yl)methyl-triphenylphosphanium bromide |
| SMILES | COc1cc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc2c1OC(C)(C)C2.[Br-] |
| InChI | InChI=1S/C30H30O2P.BrH/c1-30(2)21-24-19-23(20-28(31-3)29(24)32-30)22-33(25-13-7-4-8-14-25,26-15-9-5-10-16-26)27-17-11-6-12-18-27;/h4-20H,21-22H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | KTCUDRGAZFGMRY-UHFFFAOYSA-M |
| XLogP | 2.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 533.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (7-methoxy-2,2-dimethyl-3H-1-benzofuran-5-yl)methyl-triphenylphosphanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methoxy-2,2-dimethyl-3H-1-benzofuran-5-yl)methyl-triphenylphosphanium bromide?
The IUPAC name of (7-methoxy-2,2-dimethyl-3H-1-benzofuran-5-yl)methyl-triphenylphosphanium bromide (CID 22343760) is (7-methoxy-2,2-dimethyl-3H-1-benzofuran-5-yl)methyl-triphenylphosphanium bromide.
What is the SMILES notation for (7-methoxy-2,2-dimethyl-3H-1-benzofuran-5-yl)methyl-triphenylphosphanium bromide?
The canonical SMILES for (7-methoxy-2,2-dimethyl-3H-1-benzofuran-5-yl)methyl-triphenylphosphanium bromide is COc1cc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc2c1OC(C)(C)C2.[Br-].
What is the InChIKey of (7-methoxy-2,2-dimethyl-3H-1-benzofuran-5-yl)methyl-triphenylphosphanium bromide?
The InChIKey is KTCUDRGAZFGMRY-UHFFFAOYSA-M. The full InChI is InChI=1S/C30H30O2P.BrH/c1-30(2)21-24-19-23(20-28(31-3)29(24)32-30)22-33(25-13-7-4-8-14-25,26-15-9-5-10-16-26)27-17-11-6-12-18-27;/h4-20H,21-22H2,1-3H3;1H/q+1;/p-1.
What are the key properties of (7-methoxy-2,2-dimethyl-3H-1-benzofuran-5-yl)methyl-triphenylphosphanium bromide?
(7-methoxy-2,2-dimethyl-3H-1-benzofuran-5-yl)methyl-triphenylphosphanium bromide has a molecular weight of 533.45 g/mol, XLogP of 2.91, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methoxy-2,2-dimethyl-3H-1-benzofuran-5-yl)methyl-triphenylphosphanium bromide is sourced from PubChem (CID 22343760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).