C20H25N3O4 — CID 22344462
6-(2-cyano-3-methylanilino)-2-methoxycarbonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxylic acid (PubChem CID 22344462) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 6-(2-cyano-3-methylanilino)-2-methoxycarbonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxylic acid.
| Compound Name | 6-(2-cyano-3-methylanilino)-2-methoxycarbonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 22344462 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 6-(2-cyano-3-methylanilino)-2-methoxycarbonyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-3-carboxylic acid |
| SMILES | COC(=O)N1CC2CCC(Nc3cccc(C)c3C#N)CC2CC1C(=O)O |
| InChI | InChI=1S/C20H25N3O4/c1-12-4-3-5-17(16(12)10-21)22-15-7-6-13-11-23(20(26)27-2)18(19(24)25)9-14(13)8-15/h3-5,13-15,18,22H,6-9,11H2,1-2H3,(H,24,25) |
| InChIKey | DWQIXPZNFDKOBD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |