C26H23F7O2S — CID 22345035
2,2,3,3,4,4,5-heptafluorooctanoate;triphenylsulfanium (PubChem CID 22345035) has the molecular formula C26H23F7O2S and a molecular weight of 532.52 g/mol. Its IUPAC name is 2,2,3,3,4,4,5-heptafluorooctanoate;triphenylsulfanium.
| Compound Name | 2,2,3,3,4,4,5-heptafluorooctanoate;triphenylsulfanium |
|---|---|
| PubChem CID | 22345035 |
| Molecular Formula | C26H23F7O2S |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 2,2,3,3,4,4,5-heptafluorooctanoate;triphenylsulfanium |
| SMILES | CCCC(F)C(F)(F)C(F)(F)C(F)(F)C(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C8H9F7O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-3-4(9)6(10,11)8(14,15)7(12,13)5(16)17/h1-15H;4H,2-3H2,1H3,(H,16,17)/q+1;/p-1 |
| InChIKey | QDSGDPIVJDQYJS-UHFFFAOYSA-M |
| XLogP | 6.56 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|