C29H21F15O2S — CID 22345043
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate;tris(4-methylphenyl)sulfanium (PubChem CID 22345043) has the molecular formula C29H21F15O2S and a molecular weight of 718.52 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate;tris(4-methylphenyl)sulfanium.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate;tris(4-methylphenyl)sulfanium |
|---|---|
| PubChem CID | 22345043 |
| Molecular Formula | C29H21F15O2S |
| Molecular Weight | 718.52 g/mol |
| Exact Mass | 718.10 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate;tris(4-methylphenyl)sulfanium |
| SMILES | Cc1ccc([S+](c2ccc(C)cc2)c2ccc(C)cc2)cc1.O=C([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H21S.C8HF15O2/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21;9-2(10,1(24)25)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23/h4-15H,1-3H3;(H,24,25)/q+1;/p-1 |
| InChIKey | YYNWYLZXXSUXRM-UHFFFAOYSA-M |
| XLogP | 8.82 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.52 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|