C17H27BO3 — CID 22345469
(5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)boronic acid (PubChem CID 22345469) has the molecular formula C17H27BO3 and a molecular weight of 290.21 g/mol. Its IUPAC name is (5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)boronic acid.
| Compound Name | (5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)boronic acid |
|---|---|
| PubChem CID | 22345469 |
| Molecular Formula | C17H27BO3 |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | (5,5,8,8-tetramethyl-3-propoxy-6,7-dihydronaphthalen-2-yl)boronic acid |
| SMILES | CCCOc1cc2c(cc1B(O)O)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C17H27BO3/c1-6-9-21-15-11-13-12(10-14(15)18(19)20)16(2,3)7-8-17(13,4)5/h10-11,19-20H,6-9H2,1-5H3 |
| InChIKey | BRZGJRZTNHHXIF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|