About N,N-diethyl-4-(1,3,4-oxadiazol-2-yl)aniline
N,N-diethyl-4-(1,3,4-oxadiazol-2-yl)aniline (PubChem CID 22345896) has the molecular formula C12H15N3O
and a molecular weight of 217.27 g/mol. Its IUPAC name is N,N-diethyl-4-(1,3,4-oxadiazol-2-yl)aniline.
Molecular Properties
| Compound Name | N,N-diethyl-4-(1,3,4-oxadiazol-2-yl)aniline |
| PubChem CID | 22345896 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | N,N-diethyl-4-(1,3,4-oxadiazol-2-yl)aniline |
| SMILES | CCN(CC)c1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C12H15N3O/c1-3-15(4-2)11-7-5-10(6-8-11)12-14-13-9-16-12/h5-9H,3-4H2,1-2H3 |
| InChIKey | ZLZOGCHGMMCHST-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-diethyl-4-(1,3,4-oxadiazol-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-4-(1,3,4-oxadiazol-2-yl)aniline?
The IUPAC name of N,N-diethyl-4-(1,3,4-oxadiazol-2-yl)aniline (CID 22345896) is N,N-diethyl-4-(1,3,4-oxadiazol-2-yl)aniline.
What is the SMILES notation for N,N-diethyl-4-(1,3,4-oxadiazol-2-yl)aniline?
The canonical SMILES for N,N-diethyl-4-(1,3,4-oxadiazol-2-yl)aniline is CCN(CC)c1ccc(-c2nnco2)cc1.
What is the InChIKey of N,N-diethyl-4-(1,3,4-oxadiazol-2-yl)aniline?
The InChIKey is ZLZOGCHGMMCHST-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O/c1-3-15(4-2)11-7-5-10(6-8-11)12-14-13-9-16-12/h5-9H,3-4H2,1-2H3.
What are the key properties of N,N-diethyl-4-(1,3,4-oxadiazol-2-yl)aniline?
N,N-diethyl-4-(1,3,4-oxadiazol-2-yl)aniline has a molecular weight of 217.27 g/mol, XLogP of 2.58, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-4-(1,3,4-oxadiazol-2-yl)aniline is sourced from PubChem (CID 22345896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).