About cyclohexane-1,1,2-tricarboxamide
cyclohexane-1,1,2-tricarboxamide (PubChem CID 22346135) has the molecular formula C9H15N3O3
and a molecular weight of 213.24 g/mol. Its IUPAC name is cyclohexane-1,1,2-tricarboxamide.
Molecular Properties
| Compound Name | cyclohexane-1,1,2-tricarboxamide |
| PubChem CID | 22346135 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | cyclohexane-1,1,2-tricarboxamide |
| SMILES | NC(=O)C1CCCCC1(C(N)=O)C(N)=O |
| InChI | InChI=1S/C9H15N3O3/c10-6(13)5-3-1-2-4-9(5,7(11)14)8(12)15/h5H,1-4H2,(H2,10,13)(H2,11,14)(H2,12,15) |
| InChIKey | KKIVBXBGEQVMSO-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane-1,1,2-tricarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane-1,1,2-tricarboxamide?
The IUPAC name of cyclohexane-1,1,2-tricarboxamide (CID 22346135) is cyclohexane-1,1,2-tricarboxamide.
What is the SMILES notation for cyclohexane-1,1,2-tricarboxamide?
The canonical SMILES for cyclohexane-1,1,2-tricarboxamide is NC(=O)C1CCCCC1(C(N)=O)C(N)=O.
What is the InChIKey of cyclohexane-1,1,2-tricarboxamide?
The InChIKey is KKIVBXBGEQVMSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O3/c10-6(13)5-3-1-2-4-9(5,7(11)14)8(12)15/h5H,1-4H2,(H2,10,13)(H2,11,14)(H2,12,15).
What are the key properties of cyclohexane-1,1,2-tricarboxamide?
cyclohexane-1,1,2-tricarboxamide has a molecular weight of 213.24 g/mol, XLogP of -1.38, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane-1,1,2-tricarboxamide is sourced from PubChem (CID 22346135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).