About 4-chloro-2,6-bis(2-chloro-4-pyridinyl)-5-(3-methylphenyl)pyrimidine
4-chloro-2,6-bis(2-chloro-4-pyridinyl)-5-(3-methylphenyl)pyrimidine (PubChem CID 22346569) has the molecular formula C21H13Cl3N4
and a molecular weight of 427.72 g/mol. Its IUPAC name is 4-chloro-2,6-bis(2-chloro-4-pyridinyl)-5-(3-methylphenyl)pyrimidine.
Molecular Properties
| Compound Name | 4-chloro-2,6-bis(2-chloro-4-pyridinyl)-5-(3-methylphenyl)pyrimidine |
| PubChem CID | 22346569 |
| Molecular Formula | C21H13Cl3N4 |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | 4-chloro-2,6-bis(2-chloro-4-pyridinyl)-5-(3-methylphenyl)pyrimidine |
| SMILES | Cc1cccc(-c2c(Cl)nc(-c3ccnc(Cl)c3)nc2-c2ccnc(Cl)c2)c1 |
| InChI | InChI=1S/C21H13Cl3N4/c1-12-3-2-4-13(9-12)18-19(14-5-7-25-16(22)10-14)27-21(28-20(18)24)15-6-8-26-17(23)11-15/h2-11H,1H3 |
| InChIKey | QJTTZIPQXVHVJQ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2,6-bis(2-chloro-4-pyridinyl)-5-(3-methylphenyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,6-bis(2-chloro-4-pyridinyl)-5-(3-methylphenyl)pyrimidine?
The IUPAC name of 4-chloro-2,6-bis(2-chloro-4-pyridinyl)-5-(3-methylphenyl)pyrimidine (CID 22346569) is 4-chloro-2,6-bis(2-chloro-4-pyridinyl)-5-(3-methylphenyl)pyrimidine.
What is the SMILES notation for 4-chloro-2,6-bis(2-chloro-4-pyridinyl)-5-(3-methylphenyl)pyrimidine?
The canonical SMILES for 4-chloro-2,6-bis(2-chloro-4-pyridinyl)-5-(3-methylphenyl)pyrimidine is Cc1cccc(-c2c(Cl)nc(-c3ccnc(Cl)c3)nc2-c2ccnc(Cl)c2)c1.
What is the InChIKey of 4-chloro-2,6-bis(2-chloro-4-pyridinyl)-5-(3-methylphenyl)pyrimidine?
The InChIKey is QJTTZIPQXVHVJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13Cl3N4/c1-12-3-2-4-13(9-12)18-19(14-5-7-25-16(22)10-14)27-21(28-20(18)24)15-6-8-26-17(23)11-15/h2-11H,1H3.
What are the key properties of 4-chloro-2,6-bis(2-chloro-4-pyridinyl)-5-(3-methylphenyl)pyrimidine?
4-chloro-2,6-bis(2-chloro-4-pyridinyl)-5-(3-methylphenyl)pyrimidine has a molecular weight of 427.72 g/mol, XLogP of 6.54, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,6-bis(2-chloro-4-pyridinyl)-5-(3-methylphenyl)pyrimidine is sourced from PubChem (CID 22346569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).