C21H25N9O — CID 22346761
3-(4-amino-3-methoxyphenyl)-1-[1-(1H-imidazol-2-ylmethyl)piperidin-4-yl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 22346761) has the molecular formula C21H25N9O and a molecular weight of 419.49 g/mol. Its IUPAC name is 3-(4-amino-3-methoxyphenyl)-1-[1-(1H-imidazol-2-ylmethyl)piperidin-4-yl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-(4-amino-3-methoxyphenyl)-1-[1-(1H-imidazol-2-ylmethyl)piperidin-4-yl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 22346761 |
| Molecular Formula | C21H25N9O |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 3-(4-amino-3-methoxyphenyl)-1-[1-(1H-imidazol-2-ylmethyl)piperidin-4-yl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | COc1cc(-c2nn(C3CCN(Cc4ncc[nH]4)CC3)c3ncnc(N)c23)ccc1N |
| InChI | InChI=1S/C21H25N9O/c1-31-16-10-13(2-3-15(16)22)19-18-20(23)26-12-27-21(18)30(28-19)14-4-8-29(9-5-14)11-17-24-6-7-25-17/h2-3,6-7,10,12,14H,4-5,8-9,11,22H2,1H3,(H,24,25)(H2,23,26,27) |
| InChIKey | XYFSZXWKLRHTAU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|