C25H31N5O — CID 22347210
1-methyl-4-[4-[3-(6-phenoxy-3-pyridinyl)pyrazol-1-yl]cyclohexyl]piperazine (PubChem CID 22347210) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is 1-methyl-4-[4-[3-(6-phenoxy-3-pyridinyl)pyrazol-1-yl]cyclohexyl]piperazine.
| Compound Name | 1-methyl-4-[4-[3-(6-phenoxy-3-pyridinyl)pyrazol-1-yl]cyclohexyl]piperazine |
|---|---|
| PubChem CID | 22347210 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 1-methyl-4-[4-[3-(6-phenoxy-3-pyridinyl)pyrazol-1-yl]cyclohexyl]piperazine |
| SMILES | CN1CCN(C2CCC(n3ccc(-c4ccc(Oc5ccccc5)nc4)n3)CC2)CC1 |
| InChI | InChI=1S/C25H31N5O/c1-28-15-17-29(18-16-28)21-8-10-22(11-9-21)30-14-13-24(27-30)20-7-12-25(26-19-20)31-23-5-3-2-4-6-23/h2-7,12-14,19,21-22H,8-11,15-18H2,1H3 |
| InChIKey | FKQADWASVVEAEY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |