C18H21BrN2O5 — CID 2234749
methyl (4R,5R)-4-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate (PubChem CID 2234749) has the molecular formula C18H21BrN2O5 and a molecular weight of 425.28 g/mol. Its IUPAC name is methyl (4R,5R)-4-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate.
| Compound Name | methyl (4R,5R)-4-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 2234749 |
| Molecular Formula | C18H21BrN2O5 |
| Molecular Weight | 425.28 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | methyl (4R,5R)-4-(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)-6-methylidene-2-oxo-1,3-diazinane-5-carboxylate |
| SMILES | C=CCOc1c(Br)cc(C2NC(=O)NC(=C)[C@@H]2C(=O)OC)cc1OCC |
| InChI | InChI=1S/C18H21BrN2O5/c1-5-7-26-16-12(19)8-11(9-13(16)25-6-2)15-14(17(22)24-4)10(3)20-18(23)21-15/h5,8-9,14-15H,1,3,6-7H2,2,4H3,(H2,20,21,23)/t14-,15?/m0/s1 |
| InChIKey | YZEGDIJCCLXGHN-MLCCFXAWSA-N |
| XLogP | 3.07 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|