C18H27BrO3 — CID 22347862
7-bromo-5-(2-methoxyethoxymethoxy)-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (PubChem CID 22347862) has the molecular formula C18H27BrO3 and a molecular weight of 371.32 g/mol. Its IUPAC name is 7-bromo-5-(2-methoxyethoxymethoxy)-1,1,4,4-tetramethyl-2,3-dihydronaphthalene.
| Compound Name | 7-bromo-5-(2-methoxyethoxymethoxy)-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 22347862 |
| Molecular Formula | C18H27BrO3 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 7-bromo-5-(2-methoxyethoxymethoxy)-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| SMILES | COCCOCOc1cc(Br)cc2c1C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C18H27BrO3/c1-17(2)6-7-18(3,4)16-14(17)10-13(19)11-15(16)22-12-21-9-8-20-5/h10-11H,6-9,12H2,1-5H3 |
| InChIKey | CLEGXLAUWJQDCP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|