C44H44O8P2 — CID 22347898
phosphono [2,3,5,6-tetrakis(2,6-dimethylphenyl)-4-(4-hydroxyphenyl)phenyl] hydrogen phosphate (PubChem CID 22347898) has the molecular formula C44H44O8P2 and a molecular weight of 762.78 g/mol. Its IUPAC name is phosphono [2,3,5,6-tetrakis(2,6-dimethylphenyl)-4-(4-hydroxyphenyl)phenyl] hydrogen phosphate.
| Compound Name | phosphono [2,3,5,6-tetrakis(2,6-dimethylphenyl)-4-(4-hydroxyphenyl)phenyl] hydrogen phosphate |
|---|---|
| PubChem CID | 22347898 |
| Molecular Formula | C44H44O8P2 |
| Molecular Weight | 762.78 g/mol |
| Exact Mass | 762.25 |
| IUPAC Name | phosphono [2,3,5,6-tetrakis(2,6-dimethylphenyl)-4-(4-hydroxyphenyl)phenyl] hydrogen phosphate |
| SMILES | Cc1cccc(C)c1-c1c(OP(=O)(O)OP(=O)(O)O)c(-c2c(C)cccc2C)c(-c2c(C)cccc2C)c(-c2ccc(O)cc2)c1-c1c(C)cccc1C |
| InChI | InChI=1S/C44H44O8P2/c1-25-13-9-14-26(2)35(25)40-39(33-21-23-34(45)24-22-33)41(36-27(3)15-10-16-28(36)4)43(38-31(7)19-12-20-32(38)8)44(51-54(49,50)52-53(46,47)48)42(40)37-29(5)17-11-18-30(37)6/h9-24,45H,1-8H3,(H,49,50)(H2,46,47,48) |
| InChIKey | XFXCDLNEYCLNKV-UHFFFAOYSA-N |
| XLogP | 11.78 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.78 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|