About 4-[1,3-benzoxazol-5-ylmethyl(piperidin-4-yl)amino]-6-methoxychromen-2-one
4-[1,3-benzoxazol-5-ylmethyl(piperidin-4-yl)amino]-6-methoxychromen-2-one (PubChem CID 22348068) has the molecular formula C23H23N3O4
and a molecular weight of 405.45 g/mol. Its IUPAC name is 4-[1,3-benzoxazol-5-ylmethyl(piperidin-4-yl)amino]-6-methoxychromen-2-one.
Molecular Properties
| Compound Name | 4-[1,3-benzoxazol-5-ylmethyl(piperidin-4-yl)amino]-6-methoxychromen-2-one |
| PubChem CID | 22348068 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 4-[1,3-benzoxazol-5-ylmethyl(piperidin-4-yl)amino]-6-methoxychromen-2-one |
| SMILES | COc1ccc2oc(=O)cc(N(Cc3ccc4ocnc4c3)C3CCNCC3)c2c1 |
| InChI | InChI=1S/C23H23N3O4/c1-28-17-3-5-21-18(11-17)20(12-23(27)30-21)26(16-6-8-24-9-7-16)13-15-2-4-22-19(10-15)25-14-29-22/h2-5,10-12,14,16,24H,6-9,13H2,1H3 |
| InChIKey | MTANBAJIPWQGTR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-[1,3-benzoxazol-5-ylmethyl(piperidin-4-yl)amino]-6-methoxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1,3-benzoxazol-5-ylmethyl(piperidin-4-yl)amino]-6-methoxychromen-2-one?
The IUPAC name of 4-[1,3-benzoxazol-5-ylmethyl(piperidin-4-yl)amino]-6-methoxychromen-2-one (CID 22348068) is 4-[1,3-benzoxazol-5-ylmethyl(piperidin-4-yl)amino]-6-methoxychromen-2-one.
What is the SMILES notation for 4-[1,3-benzoxazol-5-ylmethyl(piperidin-4-yl)amino]-6-methoxychromen-2-one?
The canonical SMILES for 4-[1,3-benzoxazol-5-ylmethyl(piperidin-4-yl)amino]-6-methoxychromen-2-one is COc1ccc2oc(=O)cc(N(Cc3ccc4ocnc4c3)C3CCNCC3)c2c1.
What is the InChIKey of 4-[1,3-benzoxazol-5-ylmethyl(piperidin-4-yl)amino]-6-methoxychromen-2-one?
The InChIKey is MTANBAJIPWQGTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N3O4/c1-28-17-3-5-21-18(11-17)20(12-23(27)30-21)26(16-6-8-24-9-7-16)13-15-2-4-22-19(10-15)25-14-29-22/h2-5,10-12,14,16,24H,6-9,13H2,1H3.
What are the key properties of 4-[1,3-benzoxazol-5-ylmethyl(piperidin-4-yl)amino]-6-methoxychromen-2-one?
4-[1,3-benzoxazol-5-ylmethyl(piperidin-4-yl)amino]-6-methoxychromen-2-one has a molecular weight of 405.45 g/mol, XLogP of 3.70, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1,3-benzoxazol-5-ylmethyl(piperidin-4-yl)amino]-6-methoxychromen-2-one is sourced from PubChem (CID 22348068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).