C54H18BF15O3 — CID 22348485
tris(2,3,4,5,6-pentafluorobenzo[a]anthracen-1-yl) borate (PubChem CID 22348485) has the molecular formula C54H18BF15O3 and a molecular weight of 1010.52 g/mol. Its IUPAC name is tris(2,3,4,5,6-pentafluorobenzo[a]anthracen-1-yl) borate.
| Compound Name | tris(2,3,4,5,6-pentafluorobenzo[a]anthracen-1-yl) borate |
|---|---|
| PubChem CID | 22348485 |
| Molecular Formula | C54H18BF15O3 |
| Molecular Weight | 1010.52 g/mol |
| Exact Mass | 1010.11 |
| IUPAC Name | tris(2,3,4,5,6-pentafluorobenzo[a]anthracen-1-yl) borate |
| SMILES | Fc1c(F)c(OB(Oc2c(F)c(F)c(F)c3c(F)c(F)c4cc5ccccc5cc4c23)Oc2c(F)c(F)c(F)c3c(F)c(F)c4cc5ccccc5cc4c23)c2c(c1F)c(F)c(F)c1cc3ccccc3cc12 |
| InChI | InChI=1S/C54H18BF15O3/c56-37-28-16-22-10-4-1-7-19(22)13-25(28)31-34(40(37)59)43(62)46(65)49(68)52(31)71-55(72-53-32-26-14-20-8-2-5-11-23(20)17-29(26)38(57)41(60)35(32)44(63)47(66)50(53)69)73-54-33-27-15-21-9-3-6-12-24(21)18-30(27)39(58)42(61)36(33)45(64)48(67)51(54)70/h1-18H |
| InChIKey | YJOSHSROWMDOGX-UHFFFAOYSA-N |
| XLogP | 16.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1010.52 |
| LogP ≤ 5 | 16.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|