C12H4F7N — CID 22348698
2,3,4,5-tetrafluoro-N-(2,3,5-trifluorophenyl)aniline (PubChem CID 22348698) has the molecular formula C12H4F7N and a molecular weight of 295.16 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-(2,3,5-trifluorophenyl)aniline.
| Compound Name | 2,3,4,5-tetrafluoro-N-(2,3,5-trifluorophenyl)aniline |
|---|---|
| PubChem CID | 22348698 |
| Molecular Formula | C12H4F7N |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-(2,3,5-trifluorophenyl)aniline |
| SMILES | Fc1cc(F)c(F)c(Nc2cc(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C12H4F7N/c13-4-1-5(14)9(16)7(2-4)20-8-3-6(15)10(17)12(19)11(8)18/h1-3,20H |
| InChIKey | SSEREQJCBJMONO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|