C7H2F15N — CID 22348768
1,1,1,2,2,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptan-3-amine (PubChem CID 22348768) has the molecular formula C7H2F15N and a molecular weight of 385.07 g/mol. Its IUPAC name is 1,1,1,2,2,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptan-3-amine.
| Compound Name | 1,1,1,2,2,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptan-3-amine |
|---|---|
| PubChem CID | 22348768 |
| Molecular Formula | C7H2F15N |
| Molecular Weight | 385.07 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | 1,1,1,2,2,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptan-3-amine |
| SMILES | NC(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H2F15N/c8-1(9,3(12,13)6(17,18)19)2(10,11)5(16,23)4(14,15)7(20,21)22/h23H2 |
| InChIKey | XXTCVJFKQRFEIW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.07 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|