C8H13F6N — CID 22348872
1,1,1,2,2,3-hexafluoro-6-methylheptan-3-amine (PubChem CID 22348872) has the molecular formula C8H13F6N and a molecular weight of 237.19 g/mol. Its IUPAC name is 1,1,1,2,2,3-hexafluoro-6-methylheptan-3-amine.
| Compound Name | 1,1,1,2,2,3-hexafluoro-6-methylheptan-3-amine |
|---|---|
| PubChem CID | 22348872 |
| Molecular Formula | C8H13F6N |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 1,1,1,2,2,3-hexafluoro-6-methylheptan-3-amine |
| SMILES | CC(C)CCC(N)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H13F6N/c1-5(2)3-4-6(9,15)7(10,11)8(12,13)14/h5H,3-4,15H2,1-2H3 |
| InChIKey | FKLSVRYWTYOHLT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|