C14H27F4N — CID 22348889
2,3,6,7-tetrafluoro-N-(4-methylpentyl)octan-1-amine (PubChem CID 22348889) has the molecular formula C14H27F4N and a molecular weight of 285.37 g/mol. Its IUPAC name is 2,3,6,7-tetrafluoro-N-(4-methylpentyl)octan-1-amine.
| Compound Name | 2,3,6,7-tetrafluoro-N-(4-methylpentyl)octan-1-amine |
|---|---|
| PubChem CID | 22348889 |
| Molecular Formula | C14H27F4N |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 2,3,6,7-tetrafluoro-N-(4-methylpentyl)octan-1-amine |
| SMILES | CC(C)CCCNCC(F)C(F)CCC(F)C(C)F |
| InChI | InChI=1S/C14H27F4N/c1-10(2)5-4-8-19-9-14(18)13(17)7-6-12(16)11(3)15/h10-14,19H,4-9H2,1-3H3 |
| InChIKey | WUDGGUKBTSQXHA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|