C24H26N6O2 — CID 22349293
2-[(1-cyclopropyl-2-oxoimidazo[4,5-c]pyridin-3-yl)methyl]-1-(6-hydroxyhexyl)benzimidazole-5-carbonitrile (PubChem CID 22349293) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-[(1-cyclopropyl-2-oxoimidazo[4,5-c]pyridin-3-yl)methyl]-1-(6-hydroxyhexyl)benzimidazole-5-carbonitrile.
| Compound Name | 2-[(1-cyclopropyl-2-oxoimidazo[4,5-c]pyridin-3-yl)methyl]-1-(6-hydroxyhexyl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 22349293 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 2-[(1-cyclopropyl-2-oxoimidazo[4,5-c]pyridin-3-yl)methyl]-1-(6-hydroxyhexyl)benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)nc(Cn1c(=O)n(C3CC3)c3ccncc31)n2CCCCCCO |
| InChI | InChI=1S/C24H26N6O2/c25-14-17-5-8-20-19(13-17)27-23(28(20)11-3-1-2-4-12-31)16-29-22-15-26-10-9-21(22)30(24(29)32)18-6-7-18/h5,8-10,13,15,18,31H,1-4,6-7,11-12,16H2 |
| InChIKey | LXHLPXANXSTIAB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|