C24H26N4O7 — CID 22349449
5-[4-[1-(2-hydroxy-2-methylpropyl)indazol-5-yl]oxyphenoxy]-5-(2-methoxyethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 22349449) has the molecular formula C24H26N4O7 and a molecular weight of 482.49 g/mol. Its IUPAC name is 5-[4-[1-(2-hydroxy-2-methylpropyl)indazol-5-yl]oxyphenoxy]-5-(2-methoxyethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[4-[1-(2-hydroxy-2-methylpropyl)indazol-5-yl]oxyphenoxy]-5-(2-methoxyethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 22349449 |
| Molecular Formula | C24H26N4O7 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 5-[4-[1-(2-hydroxy-2-methylpropyl)indazol-5-yl]oxyphenoxy]-5-(2-methoxyethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | COCCC1(Oc2ccc(Oc3ccc4c(cnn4CC(C)(C)O)c3)cc2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C24H26N4O7/c1-23(2,32)14-28-19-9-8-18(12-15(19)13-25-28)34-16-4-6-17(7-5-16)35-24(10-11-33-3)20(29)26-22(31)27-21(24)30/h4-9,12-13,32H,10-11,14H2,1-3H3,(H2,26,27,29,30,31) |
| InChIKey | YANFZSAWAFMKAT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 141.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|