C27H21N5O6 — CID 22349474
2-[5-[4-[[5-(2-methoxyethyl)-2,4,6-trioxo-1,3-diazinan-5-yl]oxy]phenoxy]indazol-1-yl]benzonitrile (PubChem CID 22349474) has the molecular formula C27H21N5O6 and a molecular weight of 511.49 g/mol. Its IUPAC name is 2-[5-[4-[[5-(2-methoxyethyl)-2,4,6-trioxo-1,3-diazinan-5-yl]oxy]phenoxy]indazol-1-yl]benzonitrile.
| Compound Name | 2-[5-[4-[[5-(2-methoxyethyl)-2,4,6-trioxo-1,3-diazinan-5-yl]oxy]phenoxy]indazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 22349474 |
| Molecular Formula | C27H21N5O6 |
| Molecular Weight | 511.49 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | 2-[5-[4-[[5-(2-methoxyethyl)-2,4,6-trioxo-1,3-diazinan-5-yl]oxy]phenoxy]indazol-1-yl]benzonitrile |
| SMILES | COCCC1(Oc2ccc(Oc3ccc4c(cnn4-c4ccccc4C#N)c3)cc2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C27H21N5O6/c1-36-13-12-27(24(33)30-26(35)31-25(27)34)38-20-8-6-19(7-9-20)37-21-10-11-23-18(14-21)16-29-32(23)22-5-3-2-4-17(22)15-28/h2-11,14,16H,12-13H2,1H3,(H2,30,31,33,34,35) |
| InChIKey | ONNXBHWLSIHGOM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 144.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|