About 2-(2-amino-1,3-thiazol-5-yl)acetamide
2-(2-amino-1,3-thiazol-5-yl)acetamide (PubChem CID 22349615) has the molecular formula C5H7N3OS
and a molecular weight of 157.20 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-5-yl)acetamide.
Molecular Properties
| Compound Name | 2-(2-amino-1,3-thiazol-5-yl)acetamide |
| PubChem CID | 22349615 |
| Molecular Formula | C5H7N3OS |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-5-yl)acetamide |
| SMILES | NC(=O)Cc1cnc(N)s1 |
| InChI | InChI=1S/C5H7N3OS/c6-4(9)1-3-2-8-5(7)10-3/h2H,1H2,(H2,6,9)(H2,7,8) |
| InChIKey | TVIOGJOQDHFMAW-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-amino-1,3-thiazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-1,3-thiazol-5-yl)acetamide?
The IUPAC name of 2-(2-amino-1,3-thiazol-5-yl)acetamide (CID 22349615) is 2-(2-amino-1,3-thiazol-5-yl)acetamide.
What is the SMILES notation for 2-(2-amino-1,3-thiazol-5-yl)acetamide?
The canonical SMILES for 2-(2-amino-1,3-thiazol-5-yl)acetamide is NC(=O)Cc1cnc(N)s1.
What is the InChIKey of 2-(2-amino-1,3-thiazol-5-yl)acetamide?
The InChIKey is TVIOGJOQDHFMAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3OS/c6-4(9)1-3-2-8-5(7)10-3/h2H,1H2,(H2,6,9)(H2,7,8).
What are the key properties of 2-(2-amino-1,3-thiazol-5-yl)acetamide?
2-(2-amino-1,3-thiazol-5-yl)acetamide has a molecular weight of 157.20 g/mol, XLogP of -0.25, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-1,3-thiazol-5-yl)acetamide is sourced from PubChem (CID 22349615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).