About bis(1-(cyclopropylsulfanylmethyl)-4-methylsulfanylbenzene);sulfane
bis(1-(cyclopropylsulfanylmethyl)-4-methylsulfanylbenzene);sulfane (PubChem CID 22350142) has the molecular formula C22H30S5
and a molecular weight of 454.82 g/mol. Its IUPAC name is bis(1-(cyclopropylsulfanylmethyl)-4-methylsulfanylbenzene);sulfane.
Molecular Properties
| Compound Name | bis(1-(cyclopropylsulfanylmethyl)-4-methylsulfanylbenzene);sulfane |
| PubChem CID | 22350142 |
| Molecular Formula | C22H30S5 |
| Molecular Weight | 454.82 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | bis(1-(cyclopropylsulfanylmethyl)-4-methylsulfanylbenzene);sulfane |
| SMILES | CSc1ccc(CSC2CC2)cc1.CSc1ccc(CSC2CC2)cc1.S |
| InChI | InChI=1S/2C11H14S2.H2S/c2*1-12-10-4-2-9(3-5-10)8-13-11-6-7-11;/h2*2-5,11H,6-8H2,1H3;1H2 |
| InChIKey | SKCZKHHWUADTOT-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.82 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(1-(cyclopropylsulfanylmethyl)-4-methylsulfanylbenzene);sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-(cyclopropylsulfanylmethyl)-4-methylsulfanylbenzene);sulfane?
The IUPAC name of bis(1-(cyclopropylsulfanylmethyl)-4-methylsulfanylbenzene);sulfane (CID 22350142) is bis(1-(cyclopropylsulfanylmethyl)-4-methylsulfanylbenzene);sulfane.
What is the SMILES notation for bis(1-(cyclopropylsulfanylmethyl)-4-methylsulfanylbenzene);sulfane?
The canonical SMILES for bis(1-(cyclopropylsulfanylmethyl)-4-methylsulfanylbenzene);sulfane is CSc1ccc(CSC2CC2)cc1.CSc1ccc(CSC2CC2)cc1.S.
What is the InChIKey of bis(1-(cyclopropylsulfanylmethyl)-4-methylsulfanylbenzene);sulfane?
The InChIKey is SKCZKHHWUADTOT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H14S2.H2S/c2*1-12-10-4-2-9(3-5-10)8-13-11-6-7-11;/h2*2-5,11H,6-8H2,1H3;1H2.
What are the key properties of bis(1-(cyclopropylsulfanylmethyl)-4-methylsulfanylbenzene);sulfane?
bis(1-(cyclopropylsulfanylmethyl)-4-methylsulfanylbenzene);sulfane has a molecular weight of 454.82 g/mol, XLogP of 7.72, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-(cyclopropylsulfanylmethyl)-4-methylsulfanylbenzene);sulfane is sourced from PubChem (CID 22350142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).