C12H15BrN2OS — CID 22350665
N-(1-azabicyclo[3.2.1]octan-3-yl)-5-bromothiophene-2-carboxamide (PubChem CID 22350665) has the molecular formula C12H15BrN2OS and a molecular weight of 315.24 g/mol. Its IUPAC name is N-(1-azabicyclo[3.2.1]octan-3-yl)-5-bromothiophene-2-carboxamide.
| Compound Name | N-(1-azabicyclo[3.2.1]octan-3-yl)-5-bromothiophene-2-carboxamide |
|---|---|
| PubChem CID | 22350665 |
| Molecular Formula | C12H15BrN2OS |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | N-(1-azabicyclo[3.2.1]octan-3-yl)-5-bromothiophene-2-carboxamide |
| SMILES | O=C(NC1CC2CCN(C2)C1)c1ccc(Br)s1 |
| InChI | InChI=1S/C12H15BrN2OS/c13-11-2-1-10(17-11)12(16)14-9-5-8-3-4-15(6-8)7-9/h1-2,8-9H,3-7H2,(H,14,16) |
| InChIKey | SRPBEPYOFYCVOB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |