About 5-(2-aminophenyl)-N-(2-azabicyclo[2.2.1]heptan-6-yl)-1,3-oxazole-2-carboxamide
5-(2-aminophenyl)-N-(2-azabicyclo[2.2.1]heptan-6-yl)-1,3-oxazole-2-carboxamide (PubChem CID 22350867) has the molecular formula C16H18N4O2
and a molecular weight of 298.35 g/mol. Its IUPAC name is 5-(2-aminophenyl)-N-(2-azabicyclo[2.2.1]heptan-6-yl)-1,3-oxazole-2-carboxamide.
Molecular Properties
| Compound Name | 5-(2-aminophenyl)-N-(2-azabicyclo[2.2.1]heptan-6-yl)-1,3-oxazole-2-carboxamide |
| PubChem CID | 22350867 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 5-(2-aminophenyl)-N-(2-azabicyclo[2.2.1]heptan-6-yl)-1,3-oxazole-2-carboxamide |
| SMILES | Nc1ccccc1-c1cnc(C(=O)NC2CC3CNC2C3)o1 |
| InChI | InChI=1S/C16H18N4O2/c17-11-4-2-1-3-10(11)14-8-19-16(22-14)15(21)20-13-6-9-5-12(13)18-7-9/h1-4,8-9,12-13,18H,5-7,17H2,(H,20,21) |
| InChIKey | FZPJWRCYIQRDFV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-aminophenyl)-N-(2-azabicyclo[2.2.1]heptan-6-yl)-1,3-oxazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-aminophenyl)-N-(2-azabicyclo[2.2.1]heptan-6-yl)-1,3-oxazole-2-carboxamide?
The IUPAC name of 5-(2-aminophenyl)-N-(2-azabicyclo[2.2.1]heptan-6-yl)-1,3-oxazole-2-carboxamide (CID 22350867) is 5-(2-aminophenyl)-N-(2-azabicyclo[2.2.1]heptan-6-yl)-1,3-oxazole-2-carboxamide.
What is the SMILES notation for 5-(2-aminophenyl)-N-(2-azabicyclo[2.2.1]heptan-6-yl)-1,3-oxazole-2-carboxamide?
The canonical SMILES for 5-(2-aminophenyl)-N-(2-azabicyclo[2.2.1]heptan-6-yl)-1,3-oxazole-2-carboxamide is Nc1ccccc1-c1cnc(C(=O)NC2CC3CNC2C3)o1.
What is the InChIKey of 5-(2-aminophenyl)-N-(2-azabicyclo[2.2.1]heptan-6-yl)-1,3-oxazole-2-carboxamide?
The InChIKey is FZPJWRCYIQRDFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4O2/c17-11-4-2-1-3-10(11)14-8-19-16(22-14)15(21)20-13-6-9-5-12(13)18-7-9/h1-4,8-9,12-13,18H,5-7,17H2,(H,20,21).
What are the key properties of 5-(2-aminophenyl)-N-(2-azabicyclo[2.2.1]heptan-6-yl)-1,3-oxazole-2-carboxamide?
5-(2-aminophenyl)-N-(2-azabicyclo[2.2.1]heptan-6-yl)-1,3-oxazole-2-carboxamide has a molecular weight of 298.35 g/mol, XLogP of 1.40, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-aminophenyl)-N-(2-azabicyclo[2.2.1]heptan-6-yl)-1,3-oxazole-2-carboxamide is sourced from PubChem (CID 22350867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).