About 4-bromopiperidine-2,6-dione
4-bromopiperidine-2,6-dione (PubChem CID 22351194) has the molecular formula C5H6BrNO2
and a molecular weight of 192.01 g/mol. Its IUPAC name is 4-bromopiperidine-2,6-dione.
Molecular Properties
| Compound Name | 4-bromopiperidine-2,6-dione |
| PubChem CID | 22351194 |
| Molecular Formula | C5H6BrNO2 |
| Molecular Weight | 192.01 g/mol |
| Exact Mass | 190.96 |
| IUPAC Name | 4-bromopiperidine-2,6-dione |
| SMILES | O=C1CC(Br)CC(=O)N1 |
| InChI | InChI=1S/C5H6BrNO2/c6-3-1-4(8)7-5(9)2-3/h3H,1-2H2,(H,7,8,9) |
| InChIKey | BMZYKOJCIOOVGY-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.01 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromopiperidine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromopiperidine-2,6-dione?
The IUPAC name of 4-bromopiperidine-2,6-dione (CID 22351194) is 4-bromopiperidine-2,6-dione.
What is the SMILES notation for 4-bromopiperidine-2,6-dione?
The canonical SMILES for 4-bromopiperidine-2,6-dione is O=C1CC(Br)CC(=O)N1.
What is the InChIKey of 4-bromopiperidine-2,6-dione?
The InChIKey is BMZYKOJCIOOVGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6BrNO2/c6-3-1-4(8)7-5(9)2-3/h3H,1-2H2,(H,7,8,9).
What are the key properties of 4-bromopiperidine-2,6-dione?
4-bromopiperidine-2,6-dione has a molecular weight of 192.01 g/mol, XLogP of 0.19, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromopiperidine-2,6-dione is sourced from PubChem (CID 22351194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).