About 4-sulfanylbenzamide
4-sulfanylbenzamide (PubChem CID 22351612) has the molecular formula C7H7NOS
and a molecular weight of 153.21 g/mol. Its IUPAC name is 4-sulfanylbenzamide.
Molecular Properties
| Compound Name | 4-sulfanylbenzamide |
| PubChem CID | 22351612 |
| Molecular Formula | C7H7NOS |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.02 |
| IUPAC Name | 4-sulfanylbenzamide |
| SMILES | NC(=O)c1ccc(S)cc1 |
| InChI | InChI=1S/C7H7NOS/c8-7(9)5-1-3-6(10)4-2-5/h1-4,10H,(H2,8,9) |
| InChIKey | CTOUXQDUYJORQK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-sulfanylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-sulfanylbenzamide?
The IUPAC name of 4-sulfanylbenzamide (CID 22351612) is 4-sulfanylbenzamide.
What is the SMILES notation for 4-sulfanylbenzamide?
The canonical SMILES for 4-sulfanylbenzamide is NC(=O)c1ccc(S)cc1.
What is the InChIKey of 4-sulfanylbenzamide?
The InChIKey is CTOUXQDUYJORQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NOS/c8-7(9)5-1-3-6(10)4-2-5/h1-4,10H,(H2,8,9).
What are the key properties of 4-sulfanylbenzamide?
4-sulfanylbenzamide has a molecular weight of 153.21 g/mol, XLogP of 1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-sulfanylbenzamide is sourced from PubChem (CID 22351612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).