C18H4N6S2 — CID 22351674
2-[(2,4,6-tricyanophenyl)disulfanyl]benzene-1,3,5-tricarbonitrile (PubChem CID 22351674) has the molecular formula C18H4N6S2 and a molecular weight of 368.41 g/mol. Its IUPAC name is 2-[(2,4,6-tricyanophenyl)disulfanyl]benzene-1,3,5-tricarbonitrile.
| Compound Name | 2-[(2,4,6-tricyanophenyl)disulfanyl]benzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 22351674 |
| Molecular Formula | C18H4N6S2 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 2-[(2,4,6-tricyanophenyl)disulfanyl]benzene-1,3,5-tricarbonitrile |
| SMILES | N#Cc1cc(C#N)c(SSc2c(C#N)cc(C#N)cc2C#N)c(C#N)c1 |
| InChI | InChI=1S/C18H4N6S2/c19-5-11-1-13(7-21)17(14(2-11)8-22)25-26-18-15(9-23)3-12(6-20)4-16(18)10-24/h1-4H |
| InChIKey | UARWHEMYCIUGHC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|