C18H36N2O2 — CID 22352115
1-hydroxy-2,2,6,6-tetramethyl-4-(2,2,6,6-tetramethylpiperidin-1-yl)oxypiperidine (PubChem CID 22352115) has the molecular formula C18H36N2O2 and a molecular weight of 312.50 g/mol. Its IUPAC name is 1-hydroxy-2,2,6,6-tetramethyl-4-(2,2,6,6-tetramethylpiperidin-1-yl)oxypiperidine.
| Compound Name | 1-hydroxy-2,2,6,6-tetramethyl-4-(2,2,6,6-tetramethylpiperidin-1-yl)oxypiperidine |
|---|---|
| PubChem CID | 22352115 |
| Molecular Formula | C18H36N2O2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | 1-hydroxy-2,2,6,6-tetramethyl-4-(2,2,6,6-tetramethylpiperidin-1-yl)oxypiperidine |
| SMILES | CC1(C)CC(ON2C(C)(C)CCCC2(C)C)CC(C)(C)N1O |
| InChI | InChI=1S/C18H36N2O2/c1-15(2)10-9-11-16(3,4)20(15)22-14-12-17(5,6)19(21)18(7,8)13-14/h14,21H,9-13H2,1-8H3 |
| InChIKey | ZXWHCSNUGRVXHF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |