About 1,3-thiazol-2-yl carbamate
1,3-thiazol-2-yl carbamate (PubChem CID 22352149) has the molecular formula C4H4N2O2S
and a molecular weight of 144.16 g/mol. Its IUPAC name is 1,3-thiazol-2-yl carbamate.
Molecular Properties
| Compound Name | 1,3-thiazol-2-yl carbamate |
| PubChem CID | 22352149 |
| Molecular Formula | C4H4N2O2S |
| Molecular Weight | 144.16 g/mol |
| Exact Mass | 144.00 |
| IUPAC Name | 1,3-thiazol-2-yl carbamate |
| SMILES | NC(=O)Oc1nccs1 |
| InChI | InChI=1S/C4H4N2O2S/c5-3(7)8-4-6-1-2-9-4/h1-2H,(H2,5,7) |
| InChIKey | XGRVLQIKNNADIW-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.16 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-thiazol-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-thiazol-2-yl carbamate?
The IUPAC name of 1,3-thiazol-2-yl carbamate (CID 22352149) is 1,3-thiazol-2-yl carbamate.
What is the SMILES notation for 1,3-thiazol-2-yl carbamate?
The canonical SMILES for 1,3-thiazol-2-yl carbamate is NC(=O)Oc1nccs1.
What is the InChIKey of 1,3-thiazol-2-yl carbamate?
The InChIKey is XGRVLQIKNNADIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2S/c5-3(7)8-4-6-1-2-9-4/h1-2H,(H2,5,7).
What are the key properties of 1,3-thiazol-2-yl carbamate?
1,3-thiazol-2-yl carbamate has a molecular weight of 144.16 g/mol, XLogP of 0.60, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-thiazol-2-yl carbamate is sourced from PubChem (CID 22352149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).