About butyl 6-hydroxyhexanoate
butyl 6-hydroxyhexanoate (PubChem CID 22352249) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is butyl 6-hydroxyhexanoate.
Molecular Properties
| Compound Name | butyl 6-hydroxyhexanoate |
| PubChem CID | 22352249 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | butyl 6-hydroxyhexanoate |
| SMILES | CCCCOC(=O)CCCCCO |
| InChI | InChI=1S/C10H20O3/c1-2-3-9-13-10(12)7-5-4-6-8-11/h11H,2-9H2,1H3 |
| InChIKey | CEQMDSFVFKDZCR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 6-hydroxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 6-hydroxyhexanoate?
The IUPAC name of butyl 6-hydroxyhexanoate (CID 22352249) is butyl 6-hydroxyhexanoate.
What is the SMILES notation for butyl 6-hydroxyhexanoate?
The canonical SMILES for butyl 6-hydroxyhexanoate is CCCCOC(=O)CCCCCO.
What is the InChIKey of butyl 6-hydroxyhexanoate?
The InChIKey is CEQMDSFVFKDZCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-2-3-9-13-10(12)7-5-4-6-8-11/h11H,2-9H2,1H3.
What are the key properties of butyl 6-hydroxyhexanoate?
butyl 6-hydroxyhexanoate has a molecular weight of 188.27 g/mol, XLogP of 1.88, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 6-hydroxyhexanoate is sourced from PubChem (CID 22352249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).