C27H37BN2O3Si — CID 22352470
trimethyl-[2-[[3-[(E)-2-phenylethenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl]silane (PubChem CID 22352470) has the molecular formula C27H37BN2O3Si and a molecular weight of 476.50 g/mol. Its IUPAC name is trimethyl-[2-[[3-[(E)-2-phenylethenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[3-[(E)-2-phenylethenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 22352470 |
| Molecular Formula | C27H37BN2O3Si |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | trimethyl-[2-[[3-[(E)-2-phenylethenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl]silane |
| SMILES | CC1(C)OB(c2ccc3c(c2)c(/C=C/c2ccccc2)nn3COCC[Si](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C27H37BN2O3Si/c1-26(2)27(3,4)33-28(32-26)22-14-16-25-23(19-22)24(15-13-21-11-9-8-10-12-21)29-30(25)20-31-17-18-34(5,6)7/h8-16,19H,17-18,20H2,1-7H3/b15-13+ |
| InChIKey | OWKRWLSTFSEYIE-FYWRMAATSA-N |
| XLogP | 5.82 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|