C21H25F17O2S — CID 22352723
11-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)undecanoic acid (PubChem CID 22352723) has the molecular formula C21H25F17O2S and a molecular weight of 664.46 g/mol. Its IUPAC name is 11-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)undecanoic acid.
| Compound Name | 11-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)undecanoic acid |
|---|---|
| PubChem CID | 22352723 |
| Molecular Formula | C21H25F17O2S |
| Molecular Weight | 664.46 g/mol |
| Exact Mass | 664.13 |
| IUPAC Name | 11-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanyl)undecanoic acid |
| SMILES | O=C(O)CCCCCCCCCCSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H25F17O2S/c22-14(23,10-12-41-11-8-6-4-2-1-3-5-7-9-13(39)40)15(24,25)16(26,27)17(28,29)18(30,31)19(32,33)20(34,35)21(36,37)38/h1-12H2,(H,39,40) |
| InChIKey | JAYCBOCJXVSLRH-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.46 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|