About 1,3-dimethylpyrimidine-2,4-dione;hydrate
1,3-dimethylpyrimidine-2,4-dione;hydrate (PubChem CID 22352949) has the molecular formula C6H10N2O3
and a molecular weight of 158.16 g/mol. Its IUPAC name is 1,3-dimethylpyrimidine-2,4-dione;hydrate.
Molecular Properties
| Compound Name | 1,3-dimethylpyrimidine-2,4-dione;hydrate |
| PubChem CID | 22352949 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 1,3-dimethylpyrimidine-2,4-dione;hydrate |
| SMILES | Cn1ccc(=O)n(C)c1=O.O |
| InChI | InChI=1S/C6H8N2O2.H2O/c1-7-4-3-5(9)8(2)6(7)10;/h3-4H,1-2H3;1H2 |
| InChIKey | DJLJNJGRLRBXPD-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 75.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-dimethylpyrimidine-2,4-dione;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpyrimidine-2,4-dione;hydrate?
The IUPAC name of 1,3-dimethylpyrimidine-2,4-dione;hydrate (CID 22352949) is 1,3-dimethylpyrimidine-2,4-dione;hydrate.
What is the SMILES notation for 1,3-dimethylpyrimidine-2,4-dione;hydrate?
The canonical SMILES for 1,3-dimethylpyrimidine-2,4-dione;hydrate is Cn1ccc(=O)n(C)c1=O.O.
What is the InChIKey of 1,3-dimethylpyrimidine-2,4-dione;hydrate?
The InChIKey is DJLJNJGRLRBXPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2.H2O/c1-7-4-3-5(9)8(2)6(7)10;/h3-4H,1-2H3;1H2.
What are the key properties of 1,3-dimethylpyrimidine-2,4-dione;hydrate?
1,3-dimethylpyrimidine-2,4-dione;hydrate has a molecular weight of 158.16 g/mol, XLogP of -1.74, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpyrimidine-2,4-dione;hydrate is sourced from PubChem (CID 22352949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).