About 3-amino-2,4-diiminobutanoic acid
3-amino-2,4-diiminobutanoic acid (PubChem CID 22352981) has the molecular formula C4H7N3O2
and a molecular weight of 129.12 g/mol. Its IUPAC name is 3-amino-2,4-diiminobutanoic acid.
Molecular Properties
| Compound Name | 3-amino-2,4-diiminobutanoic acid |
| PubChem CID | 22352981 |
| Molecular Formula | C4H7N3O2 |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.05 |
| IUPAC Name | 3-amino-2,4-diiminobutanoic acid |
| SMILES | [H]/N=C(\C(=O)O)C(N)/C=N/[H] |
| InChI | InChI=1S/C4H7N3O2/c5-1-2(6)3(7)4(8)9/h1-2,5,7H,6H2,(H,8,9)/b5-1+,7-3- |
| InChIKey | RMVLRBNEDLQZBQ-ZFHWUWDOSA-N |
| XLogP | -0.93 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2,4-diiminobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2,4-diiminobutanoic acid?
The IUPAC name of 3-amino-2,4-diiminobutanoic acid (CID 22352981) is 3-amino-2,4-diiminobutanoic acid.
What is the SMILES notation for 3-amino-2,4-diiminobutanoic acid?
The canonical SMILES for 3-amino-2,4-diiminobutanoic acid is [H]/N=C(\C(=O)O)C(N)/C=N/[H].
What is the InChIKey of 3-amino-2,4-diiminobutanoic acid?
The InChIKey is RMVLRBNEDLQZBQ-ZFHWUWDOSA-N. The full InChI is InChI=1S/C4H7N3O2/c5-1-2(6)3(7)4(8)9/h1-2,5,7H,6H2,(H,8,9)/b5-1+,7-3-.
What are the key properties of 3-amino-2,4-diiminobutanoic acid?
3-amino-2,4-diiminobutanoic acid has a molecular weight of 129.12 g/mol, XLogP of -0.93, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,4-diiminobutanoic acid is sourced from PubChem (CID 22352981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).