About 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-nitrophenyl)ethyl]piperazine
1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-nitrophenyl)ethyl]piperazine (PubChem CID 22353141) has the molecular formula C21H21F6N3O3
and a molecular weight of 477.41 g/mol. Its IUPAC name is 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-nitrophenyl)ethyl]piperazine.
Molecular Properties
| Compound Name | 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-nitrophenyl)ethyl]piperazine |
| PubChem CID | 22353141 |
| Molecular Formula | C21H21F6N3O3 |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-nitrophenyl)ethyl]piperazine |
| SMILES | O=[N+]([O-])c1ccccc1C(COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCNCC1 |
| InChI | InChI=1S/C21H21F6N3O3/c22-20(23,24)15-9-14(10-16(11-15)21(25,26)27)12-33-13-19(29-7-5-28-6-8-29)17-3-1-2-4-18(17)30(31)32/h1-4,9-11,19,28H,5-8,12-13H2 |
| InChIKey | FTAMNSGBFIOCFN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-nitrophenyl)ethyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-nitrophenyl)ethyl]piperazine?
The IUPAC name of 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-nitrophenyl)ethyl]piperazine (CID 22353141) is 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-nitrophenyl)ethyl]piperazine.
What is the SMILES notation for 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-nitrophenyl)ethyl]piperazine?
The canonical SMILES for 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-nitrophenyl)ethyl]piperazine is O=[N+]([O-])c1ccccc1C(COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCNCC1.
What is the InChIKey of 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-nitrophenyl)ethyl]piperazine?
The InChIKey is FTAMNSGBFIOCFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F6N3O3/c22-20(23,24)15-9-14(10-16(11-15)21(25,26)27)12-33-13-19(29-7-5-28-6-8-29)17-3-1-2-4-18(17)30(31)32/h1-4,9-11,19,28H,5-8,12-13H2.
What are the key properties of 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-nitrophenyl)ethyl]piperazine?
1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-nitrophenyl)ethyl]piperazine has a molecular weight of 477.41 g/mol, XLogP of 4.80, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-(2-nitrophenyl)ethyl]piperazine is sourced from PubChem (CID 22353141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).