About benzene;2-(4-tert-butylphenyl)-1,3,4-oxadiazole
benzene;2-(4-tert-butylphenyl)-1,3,4-oxadiazole (PubChem CID 22354178) has the molecular formula C18H20N2O
and a molecular weight of 280.37 g/mol. Its IUPAC name is benzene;2-(4-tert-butylphenyl)-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | benzene;2-(4-tert-butylphenyl)-1,3,4-oxadiazole |
| PubChem CID | 22354178 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | benzene;2-(4-tert-butylphenyl)-1,3,4-oxadiazole |
| SMILES | CC(C)(C)c1ccc(-c2nnco2)cc1.c1ccccc1 |
| InChI | InChI=1S/C12H14N2O.C6H6/c1-12(2,3)10-6-4-9(5-7-10)11-14-13-8-15-11;1-2-4-6-5-3-1/h4-8H,1-3H3;1-6H |
| InChIKey | RWNSGFMBBYUGFV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzene;2-(4-tert-butylphenyl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;2-(4-tert-butylphenyl)-1,3,4-oxadiazole?
The IUPAC name of benzene;2-(4-tert-butylphenyl)-1,3,4-oxadiazole (CID 22354178) is benzene;2-(4-tert-butylphenyl)-1,3,4-oxadiazole.
What is the SMILES notation for benzene;2-(4-tert-butylphenyl)-1,3,4-oxadiazole?
The canonical SMILES for benzene;2-(4-tert-butylphenyl)-1,3,4-oxadiazole is CC(C)(C)c1ccc(-c2nnco2)cc1.c1ccccc1.
What is the InChIKey of benzene;2-(4-tert-butylphenyl)-1,3,4-oxadiazole?
The InChIKey is RWNSGFMBBYUGFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O.C6H6/c1-12(2,3)10-6-4-9(5-7-10)11-14-13-8-15-11;1-2-4-6-5-3-1/h4-8H,1-3H3;1-6H.
What are the key properties of benzene;2-(4-tert-butylphenyl)-1,3,4-oxadiazole?
benzene;2-(4-tert-butylphenyl)-1,3,4-oxadiazole has a molecular weight of 280.37 g/mol, XLogP of 4.72, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;2-(4-tert-butylphenyl)-1,3,4-oxadiazole is sourced from PubChem (CID 22354178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).