C27H37NO11S2 — CID 22354478
4-[4-[3-[bis(methylsulfonyl)amino]propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid (PubChem CID 22354478) has the molecular formula C27H37NO11S2 and a molecular weight of 615.72 g/mol. Its IUPAC name is 4-[4-[3-[bis(methylsulfonyl)amino]propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid.
| Compound Name | 4-[4-[3-[bis(methylsulfonyl)amino]propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid |
|---|---|
| PubChem CID | 22354478 |
| Molecular Formula | C27H37NO11S2 |
| Molecular Weight | 615.72 g/mol |
| Exact Mass | 615.18 |
| IUPAC Name | 4-[4-[3-[bis(methylsulfonyl)amino]propoxy]-2-methoxy-3,5,6-trimethylbenzoyl]oxy-2-methoxy-3,5,6-trimethylbenzoic acid |
| SMILES | COc1c(C)c(OC(=O)c2c(C)c(C)c(OCCCN(S(C)(=O)=O)S(C)(=O)=O)c(C)c2OC)c(C)c(C)c1C(=O)O |
| InChI | InChI=1S/C27H37NO11S2/c1-14-17(4)23(19(6)24(36-7)20(14)26(29)30)39-27(31)21-15(2)16(3)22(18(5)25(21)37-8)38-13-11-12-28(40(9,32)33)41(10,34)35/h11-13H2,1-10H3,(H,29,30) |
| InChIKey | MCMXUPDVWQPAQX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 162.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.72 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|