C15H23N5O — CID 2235451
N-cyclohexyl-4-pyrimidin-2-ylpiperazine-1-carboxamide (PubChem CID 2235451) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is N-cyclohexyl-4-pyrimidin-2-ylpiperazine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-pyrimidin-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 2235451 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | N-cyclohexyl-4-pyrimidin-2-ylpiperazine-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C15H23N5O/c21-15(18-13-5-2-1-3-6-13)20-11-9-19(10-12-20)14-16-7-4-8-17-14/h4,7-8,13H,1-3,5-6,9-12H2,(H,18,21) |
| InChIKey | GYDHLYKRFVTSGV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |