About 2-ethyl-5-phenylpyrazine
2-ethyl-5-phenylpyrazine (PubChem CID 22355264) has the molecular formula C12H12N2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-ethyl-5-phenylpyrazine.
Molecular Properties
| Compound Name | 2-ethyl-5-phenylpyrazine |
| PubChem CID | 22355264 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-ethyl-5-phenylpyrazine |
| SMILES | CCc1cnc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C12H12N2/c1-2-11-8-14-12(9-13-11)10-6-4-3-5-7-10/h3-9H,2H2,1H3 |
| InChIKey | UOPBPIXZFBCJQW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-5-phenylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-phenylpyrazine?
The IUPAC name of 2-ethyl-5-phenylpyrazine (CID 22355264) is 2-ethyl-5-phenylpyrazine.
What is the SMILES notation for 2-ethyl-5-phenylpyrazine?
The canonical SMILES for 2-ethyl-5-phenylpyrazine is CCc1cnc(-c2ccccc2)cn1.
What is the InChIKey of 2-ethyl-5-phenylpyrazine?
The InChIKey is UOPBPIXZFBCJQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2/c1-2-11-8-14-12(9-13-11)10-6-4-3-5-7-10/h3-9H,2H2,1H3.
What are the key properties of 2-ethyl-5-phenylpyrazine?
2-ethyl-5-phenylpyrazine has a molecular weight of 184.24 g/mol, XLogP of 2.71, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-phenylpyrazine is sourced from PubChem (CID 22355264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).