About 1-[3-[(6-chloro-1,3-benzodioxol-4-yl)oxy]propyl]imidazole
1-[3-[(6-chloro-1,3-benzodioxol-4-yl)oxy]propyl]imidazole (PubChem CID 22355422) has the molecular formula C13H13ClN2O3
and a molecular weight of 280.71 g/mol. Its IUPAC name is 1-[3-[(6-chloro-1,3-benzodioxol-4-yl)oxy]propyl]imidazole.
Molecular Properties
| Compound Name | 1-[3-[(6-chloro-1,3-benzodioxol-4-yl)oxy]propyl]imidazole |
| PubChem CID | 22355422 |
| Molecular Formula | C13H13ClN2O3 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 1-[3-[(6-chloro-1,3-benzodioxol-4-yl)oxy]propyl]imidazole |
| SMILES | Clc1cc(OCCCn2ccnc2)c2c(c1)OCO2 |
| InChI | InChI=1S/C13H13ClN2O3/c14-10-6-11(13-12(7-10)18-9-19-13)17-5-1-3-16-4-2-15-8-16/h2,4,6-8H,1,3,5,9H2 |
| InChIKey | YLQQERMSZSCDAU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[(6-chloro-1,3-benzodioxol-4-yl)oxy]propyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[(6-chloro-1,3-benzodioxol-4-yl)oxy]propyl]imidazole?
The IUPAC name of 1-[3-[(6-chloro-1,3-benzodioxol-4-yl)oxy]propyl]imidazole (CID 22355422) is 1-[3-[(6-chloro-1,3-benzodioxol-4-yl)oxy]propyl]imidazole.
What is the SMILES notation for 1-[3-[(6-chloro-1,3-benzodioxol-4-yl)oxy]propyl]imidazole?
The canonical SMILES for 1-[3-[(6-chloro-1,3-benzodioxol-4-yl)oxy]propyl]imidazole is Clc1cc(OCCCn2ccnc2)c2c(c1)OCO2.
What is the InChIKey of 1-[3-[(6-chloro-1,3-benzodioxol-4-yl)oxy]propyl]imidazole?
The InChIKey is YLQQERMSZSCDAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClN2O3/c14-10-6-11(13-12(7-10)18-9-19-13)17-5-1-3-16-4-2-15-8-16/h2,4,6-8H,1,3,5,9H2.
What are the key properties of 1-[3-[(6-chloro-1,3-benzodioxol-4-yl)oxy]propyl]imidazole?
1-[3-[(6-chloro-1,3-benzodioxol-4-yl)oxy]propyl]imidazole has a molecular weight of 280.71 g/mol, XLogP of 2.73, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[(6-chloro-1,3-benzodioxol-4-yl)oxy]propyl]imidazole is sourced from PubChem (CID 22355422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).